C24H25ClN4O5 — CID 11540329
4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide (PubChem CID 11540329) has the molecular formula C24H25ClN4O5 and a molecular weight of 484.94 g/mol. Its IUPAC name is 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 11540329 |
| Molecular Formula | C24H25ClN4O5 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C24H25ClN4O5/c1-32-10-9-27-23(30)17-12-16-20(13-22(17)33-2)26-8-7-21(16)34-15-5-6-19(18(25)11-15)29-24(31)28-14-3-4-14/h5-8,11-14H,3-4,9-10H2,1-2H3,(H,27,30)(H2,28,29,31) |
| InChIKey | OENTYYHQBNTPEC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|