C23H24N4O5 — CID 22936274
4-[4-(cyclopropylcarbamoylamino)-3-methylphenoxy]-N,7-dimethoxyquinoline-6-carboxamide (PubChem CID 22936274) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-[4-(cyclopropylcarbamoylamino)-3-methylphenoxy]-N,7-dimethoxyquinoline-6-carboxamide.
| Compound Name | 4-[4-(cyclopropylcarbamoylamino)-3-methylphenoxy]-N,7-dimethoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 22936274 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-[4-(cyclopropylcarbamoylamino)-3-methylphenoxy]-N,7-dimethoxyquinoline-6-carboxamide |
| SMILES | CONC(=O)c1cc2c(Oc3ccc(NC(=O)NC4CC4)c(C)c3)ccnc2cc1OC |
| InChI | InChI=1S/C23H24N4O5/c1-13-10-15(6-7-18(13)26-23(29)25-14-4-5-14)32-20-8-9-24-19-12-21(30-2)17(11-16(19)20)22(28)27-31-3/h6-12,14H,4-5H2,1-3H3,(H,27,28)(H2,25,26,29) |
| InChIKey | GGCDQQKECWIWQT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|