C28H31ClN6O5 — CID 142410632
4-[4-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide (PubChem CID 142410632) has the molecular formula C28H31ClN6O5 and a molecular weight of 567.05 g/mol. Its IUPAC name is 4-[4-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide.
| Compound Name | 4-[4-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 142410632 |
| Molecular Formula | C28H31ClN6O5 |
| Molecular Weight | 567.05 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 4-[4-[(5-tert-butyl-1H-pyrazol-3-yl)carbamoylamino]-3-chlorophenoxy]-7-methoxy-N-(2-methoxyethyl)quinoline-6-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(Oc3ccc(NC(=O)Nc4cc(C(C)(C)C)[nH]n4)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C28H31ClN6O5/c1-28(2,3)24-15-25(35-34-24)33-27(37)32-20-7-6-16(12-19(20)29)40-22-8-9-30-21-14-23(39-5)18(13-17(21)22)26(36)31-10-11-38-4/h6-9,12-15H,10-11H2,1-5H3,(H,31,36)(H3,32,33,34,35,37) |
| InChIKey | AXBPLNPMAXXKEC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.05 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|