C22H19ClN4O4 — CID 22936258
1-[2-chloro-4-[6-cyano-7-(oxiran-2-ylmethoxy)quinolin-4-yl]oxyphenyl]-3-ethylurea (PubChem CID 22936258) has the molecular formula C22H19ClN4O4 and a molecular weight of 438.87 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-cyano-7-(oxiran-2-ylmethoxy)quinolin-4-yl]oxyphenyl]-3-ethylurea.
| Compound Name | 1-[2-chloro-4-[6-cyano-7-(oxiran-2-ylmethoxy)quinolin-4-yl]oxyphenyl]-3-ethylurea |
|---|---|
| PubChem CID | 22936258 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[2-chloro-4-[6-cyano-7-(oxiran-2-ylmethoxy)quinolin-4-yl]oxyphenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(Oc2ccnc3cc(OCC4CO4)c(C#N)cc23)cc1Cl |
| InChI | InChI=1S/C22H19ClN4O4/c1-2-25-22(28)27-18-4-3-14(8-17(18)23)31-20-5-6-26-19-9-21(30-12-15-11-29-15)13(10-24)7-16(19)20/h3-9,15H,2,11-12H2,1H3,(H2,25,27,28) |
| InChIKey | UZVKHXIEPXUXCT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|