C20H17N3O3 — CID 88946677
4-(4-amino-3-methylphenoxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinoline-6-carbonitrile (PubChem CID 88946677) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-(4-amino-3-methylphenoxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinoline-6-carbonitrile.
| Compound Name | 4-(4-amino-3-methylphenoxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 88946677 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(4-amino-3-methylphenoxy)-7-[[(2R)-oxiran-2-yl]methoxy]quinoline-6-carbonitrile |
| SMILES | Cc1cc(Oc2ccnc3cc(OC[C@H]4CO4)c(C#N)cc23)ccc1N |
| InChI | InChI=1S/C20H17N3O3/c1-12-6-14(2-3-17(12)22)26-19-4-5-23-18-8-20(25-11-15-10-24-15)13(9-21)7-16(18)19/h2-8,15H,10-11,22H2,1H3/t15-/m1/s1 |
| InChIKey | NCGHACROUYVPIE-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|