C26H22N4O4 — CID 22936365
1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-phenylurea (PubChem CID 22936365) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-phenylurea.
| Compound Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 22936365 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-phenylurea |
| SMILES | COCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4ccccc4)cc3)c2cc1C#N |
| InChI | InChI=1S/C26H22N4O4/c1-32-13-14-33-25-16-23-22(15-18(25)17-27)24(11-12-28-23)34-21-9-7-20(8-10-21)30-26(31)29-19-5-3-2-4-6-19/h2-12,15-16H,13-14H2,1H3,(H2,29,30,31) |
| InChIKey | OHJZJNYXTGHUBU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|