C30H30FN5O4 — CID 67204662
1-[4-[6-cyano-7-[2-(diethylamino)-2-hydroxypropoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)urea (PubChem CID 67204662) has the molecular formula C30H30FN5O4 and a molecular weight of 543.60 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-[2-(diethylamino)-2-hydroxypropoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[6-cyano-7-[2-(diethylamino)-2-hydroxypropoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 67204662 |
| Molecular Formula | C30H30FN5O4 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-[4-[6-cyano-7-[2-(diethylamino)-2-hydroxypropoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)urea |
| SMILES | CCN(CC)C(C)(O)COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4)cc3)c2cc1C#N |
| InChI | InChI=1S/C30H30FN5O4/c1-4-36(5-2)30(3,38)19-39-28-17-26-25(16-20(28)18-32)27(14-15-33-26)40-24-12-10-23(11-13-24)35-29(37)34-22-8-6-21(31)7-9-22/h6-17,38H,4-5,19H2,1-3H3,(H2,34,35,37) |
| InChIKey | XCTILJRDCNFCCJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|