C34H37FN4O5 — CID 153329948
1-N-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;ethane (PubChem CID 153329948) has the molecular formula C34H37FN4O5 and a molecular weight of 600.69 g/mol. Its IUPAC name is 1-N-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;ethane.
| Compound Name | 1-N-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;ethane |
|---|---|
| PubChem CID | 153329948 |
| Molecular Formula | C34H37FN4O5 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 1-N-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;ethane |
| SMILES | CC.CC.COCCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1C#N |
| InChI | InChI=1S/C30H25FN4O5.2C2H6/c1-38-14-15-39-27-17-25-24(16-19(27)18-32)26(10-13-33-25)40-23-8-6-22(7-9-23)35-29(37)30(11-12-30)28(36)34-21-4-2-20(31)3-5-21;2*1-2/h2-10,13,16-17H,11-12,14-15H2,1H3,(H,34,36)(H,35,37);2*1-2H3 |
| InChIKey | AJXJADHQUPZSAI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|