C31H29FN4O7 — CID 71465938
1-N'-(4-fluorophenyl)-1-N-[4-[6-[4-(hydroxyamino)-4-oxobutoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 71465938) has the molecular formula C31H29FN4O7 and a molecular weight of 588.59 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[6-[4-(hydroxyamino)-4-oxobutoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[6-[4-(hydroxyamino)-4-oxobutoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71465938 |
| Molecular Formula | C31H29FN4O7 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[6-[4-(hydroxyamino)-4-oxobutoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1OCCCC(=O)NO |
| InChI | InChI=1S/C31H29FN4O7/c1-41-26-18-24-23(17-27(26)42-16-2-3-28(37)36-40)25(12-15-33-24)43-22-10-8-21(9-11-22)35-30(39)31(13-14-31)29(38)34-20-6-4-19(32)5-7-20/h4-12,15,17-18,40H,2-3,13-14,16H2,1H3,(H,34,38)(H,35,39)(H,36,37) |
| InChIKey | MCZBWSRACCOPSH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|