C29H24ClFN4O5 — CID 172510100
1-N-[4-[7-[(2-chloroacetyl)amino]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 172510100) has the molecular formula C29H24ClFN4O5 and a molecular weight of 562.99 g/mol. Its IUPAC name is 1-N-[4-[7-[(2-chloroacetyl)amino]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-[7-[(2-chloroacetyl)amino]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 172510100 |
| Molecular Formula | C29H24ClFN4O5 |
| Molecular Weight | 562.99 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 1-N-[4-[7-[(2-chloroacetyl)amino]-6-methoxyquinolin-4-yl]oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)ccnc2cc1NC(=O)CCl |
| InChI | InChI=1S/C29H24ClFN4O5/c1-39-25-14-21-22(15-23(25)35-26(36)16-30)32-13-10-24(21)40-20-8-6-19(7-9-20)34-28(38)29(11-12-29)27(37)33-18-4-2-17(31)3-5-18/h2-10,13-15H,11-12,16H2,1H3,(H,33,37)(H,34,38)(H,35,36) |
| InChIKey | MDNQCOPPUGBPDM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.99 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|