C28H27FN3O9P — CID 122573028
1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;phosphoric acid (PubChem CID 122573028) has the molecular formula C28H27FN3O9P and a molecular weight of 599.51 g/mol. Its IUPAC name is 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;phosphoric acid.
| Compound Name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;phosphoric acid |
|---|---|
| PubChem CID | 122573028 |
| Molecular Formula | C28H27FN3O9P |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide;phosphoric acid |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1OC.O=P(O)(O)O |
| InChI | InChI=1S/C28H24FN3O5.H3O4P/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18;1-5(2,3)4/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34);(H3,1,2,3,4) |
| InChIKey | CUDIYQYQHWGFIP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 176.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|