C31H30FN5O4 — CID 172509938
1-N'-(4-fluorophenyl)-1-N-[4-(6-methoxy-7-piperazin-1-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 172509938) has the molecular formula C31H30FN5O4 and a molecular weight of 555.61 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-(6-methoxy-7-piperazin-1-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-(6-methoxy-7-piperazin-1-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 172509938 |
| Molecular Formula | C31H30FN5O4 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-(6-methoxy-7-piperazin-1-ylquinolin-4-yl)oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)ccnc2cc1N1CCNCC1 |
| InChI | InChI=1S/C31H30FN5O4/c1-40-28-18-24-25(19-26(28)37-16-14-33-15-17-37)34-13-10-27(24)41-23-8-6-22(7-9-23)36-30(39)31(11-12-31)29(38)35-21-4-2-20(32)3-5-21/h2-10,13,18-19,33H,11-12,14-17H2,1H3,(H,35,38)(H,36,39) |
| InChIKey | VUNQPDDVSJINSB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|