C28H22FN3O5 — CID 139350474
methyl 4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinoline-6-carboxylate (PubChem CID 139350474) has the molecular formula C28H22FN3O5 and a molecular weight of 499.50 g/mol. Its IUPAC name is methyl 4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinoline-6-carboxylate.
| Compound Name | methyl 4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 139350474 |
| Molecular Formula | C28H22FN3O5 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | methyl 4-[4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2c1 |
| InChI | InChI=1S/C28H22FN3O5/c1-36-25(33)17-2-11-23-22(16-17)24(12-15-30-23)37-21-9-7-20(8-10-21)32-27(35)28(13-14-28)26(34)31-19-5-3-18(29)4-6-19/h2-12,15-16H,13-14H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | ZQBLFHUHCBZHAX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|