C32H31FN4O7 — CID 71465781
1-N'-(4-fluorophenyl)-1-N-[4-[7-[5-(hydroxyamino)-5-oxopentoxy]-6-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 71465781) has the molecular formula C32H31FN4O7 and a molecular weight of 602.62 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[7-[5-(hydroxyamino)-5-oxopentoxy]-6-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-[5-(hydroxyamino)-5-oxopentoxy]-6-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71465781 |
| Molecular Formula | C32H31FN4O7 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-[5-(hydroxyamino)-5-oxopentoxy]-6-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)ccnc2cc1OCCCCC(=O)NO |
| InChI | InChI=1S/C32H31FN4O7/c1-42-27-18-24-25(19-28(27)43-17-3-2-4-29(38)37-41)34-16-13-26(24)44-23-11-9-22(10-12-23)36-31(40)32(14-15-32)30(39)35-21-7-5-20(33)6-8-21/h5-13,16,18-19,41H,2-4,14-15,17H2,1H3,(H,35,39)(H,36,40)(H,37,38) |
| InChIKey | SHXJVRLOCRHPAI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|