C34H33ClFN3O7 — CID 139415412
7-[4-[2-chloro-3-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxyheptanoic acid (PubChem CID 139415412) has the molecular formula C34H33ClFN3O7 and a molecular weight of 650.10 g/mol. Its IUPAC name is 7-[4-[2-chloro-3-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxyheptanoic acid.
| Compound Name | 7-[4-[2-chloro-3-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 139415412 |
| Molecular Formula | C34H33ClFN3O7 |
| Molecular Weight | 650.10 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | 7-[4-[2-chloro-3-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxyheptanoic acid |
| SMILES | COc1cc2c(Oc3cccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)c3Cl)ccnc2cc1OCCCCCCC(=O)O |
| InChI | InChI=1S/C34H33ClFN3O7/c1-44-28-19-23-25(20-29(28)45-18-5-3-2-4-9-30(40)41)37-17-14-26(23)46-27-8-6-7-24(31(27)35)39-33(43)34(15-16-34)32(42)38-22-12-10-21(36)11-13-22/h6-8,10-14,17,19-20H,2-5,9,15-16,18H2,1H3,(H,38,42)(H,39,43)(H,40,41) |
| InChIKey | NOZYLIDBOXMCDQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.10 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|