C33H33FN4O7 — CID 71466000
1-N'-(4-fluorophenyl)-1-N-[4-[6-[6-(hydroxyamino)-6-oxohexoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 71466000) has the molecular formula C33H33FN4O7 and a molecular weight of 616.65 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[6-[6-(hydroxyamino)-6-oxohexoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[6-[6-(hydroxyamino)-6-oxohexoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71466000 |
| Molecular Formula | C33H33FN4O7 |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[6-[6-(hydroxyamino)-6-oxohexoxy]-7-methoxyquinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1OCCCCCC(=O)NO |
| InChI | InChI=1S/C33H33FN4O7/c1-43-28-20-26-25(19-29(28)44-18-4-2-3-5-30(39)38-42)27(14-17-35-26)45-24-12-10-23(11-13-24)37-32(41)33(15-16-33)31(40)36-22-8-6-21(34)7-9-22/h6-14,17,19-20,42H,2-5,15-16,18H2,1H3,(H,36,40)(H,37,41)(H,38,39) |
| InChIKey | MPGOLCXQPNMKTD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|