C31H27FN4O6 — CID 139350685
1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 139350685) has the molecular formula C31H27FN4O6 and a molecular weight of 570.58 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139350685 |
| Molecular Formula | C31H27FN4O6 |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[7-methoxy-6-(oxetan-3-ylcarbamoyl)quinolin-4-yl]oxyphenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3)c2cc1C(=O)NC1COC1 |
| InChI | InChI=1S/C31H27FN4O6/c1-40-27-15-25-23(14-24(27)28(37)34-21-16-41-17-21)26(10-13-33-25)42-22-8-6-20(7-9-22)36-30(39)31(11-12-31)29(38)35-19-4-2-18(32)3-5-19/h2-10,13-15,21H,11-12,16-17H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | JTAKPBCCXYBBOP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|