C24H24N4O4 — CID 10137662
1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(cyclopropylmethyl)urea (PubChem CID 10137662) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(cyclopropylmethyl)urea.
| Compound Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(cyclopropylmethyl)urea |
|---|---|
| PubChem CID | 10137662 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(cyclopropylmethyl)urea |
| SMILES | COCCOc1cc2nccc(Oc3ccc(NC(=O)NCC4CC4)cc3)c2cc1C#N |
| InChI | InChI=1S/C24H24N4O4/c1-30-10-11-31-23-13-21-20(12-17(23)14-25)22(8-9-26-21)32-19-6-4-18(5-7-19)28-24(29)27-15-16-2-3-16/h4-9,12-13,16H,2-3,10-11,15H2,1H3,(H2,27,28,29) |
| InChIKey | BWIZXIUHRLPROY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|