C26H22N4O6 — CID 89337862
1-[4-[6-cyano-7-(2-hydroperoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea (PubChem CID 89337862) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-(2-hydroperoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-[6-cyano-7-(2-hydroperoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 89337862 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[4-[6-cyano-7-(2-hydroperoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Oc3ccnc4cc(OCCOO)c(C#N)cc34)cc2)cc1 |
| InChI | InChI=1S/C26H22N4O6/c1-33-20-6-2-18(3-7-20)29-26(31)30-19-4-8-21(9-5-19)36-24-10-11-28-23-15-25(34-12-13-35-32)17(16-27)14-22(23)24/h2-11,14-15,32H,12-13H2,1H3,(H2,29,30,31) |
| InChIKey | VHTFQSGJLZCFQA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|