C27H23F2N5O5S — CID 22936572
1-[4-[6-cyano-7-[3-(methanesulfonamido)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea (PubChem CID 22936572) has the molecular formula C27H23F2N5O5S and a molecular weight of 567.57 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-[3-(methanesulfonamido)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[6-cyano-7-[3-(methanesulfonamido)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 22936572 |
| Molecular Formula | C27H23F2N5O5S |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 1-[4-[6-cyano-7-[3-(methanesulfonamido)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
| SMILES | CS(=O)(=O)NCCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4)c(F)c3)c2cc1C#N |
| InChI | InChI=1S/C27H23F2N5O5S/c1-40(36,37)32-10-2-12-38-26-15-24-21(13-17(26)16-30)25(9-11-31-24)39-20-7-8-23(22(29)14-20)34-27(35)33-19-5-3-18(28)4-6-19/h3-9,11,13-15,32H,2,10,12H2,1H3,(H2,33,34,35) |
| InChIKey | OIMHPOFBQCAIQQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|