C28H25F2N5O5S — CID 58931254
1-[4-[7-[3-(dimethylsulfamoyl)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea (PubChem CID 58931254) has the molecular formula C28H25F2N5O5S and a molecular weight of 581.60 g/mol. Its IUPAC name is 1-[4-[7-[3-(dimethylsulfamoyl)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[7-[3-(dimethylsulfamoyl)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 58931254 |
| Molecular Formula | C28H25F2N5O5S |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 1-[4-[7-[3-(dimethylsulfamoyl)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)cc4)c(F)c3)ccnc2cc1OCCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C28H25F2N5O5S/c1-31-25-16-21-24(17-27(25)39-13-4-14-41(37,38)35(2)3)32-12-11-26(21)40-20-9-10-23(22(30)15-20)34-28(36)33-19-7-5-18(29)6-8-19/h5-12,15-17H,4,13-14H2,2-3H3,(H2,33,34,36) |
| InChIKey | NPUQTXBSRMAMEH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|