C30H28FN3O3 — CID 58272299
1-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one (PubChem CID 58272299) has the molecular formula C30H28FN3O3 and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one.
| Compound Name | 1-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 58272299 |
| Molecular Formula | C30H28FN3O3 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)Cc4ccc(F)cc4)cc3)ccnc2cc1OCCCN(C)C |
| InChI | InChI=1S/C30H28FN3O3/c1-32-28-19-26-27(20-30(28)36-16-4-15-34(2)3)33-14-13-29(26)37-25-11-7-22(8-12-25)18-24(35)17-21-5-9-23(31)10-6-21/h5-14,19-20H,4,15-18H2,2-3H3 |
| InChIKey | BSXRDFLESNRQJV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 56.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|