C28H20F2N2O4 — CID 58272373
1-[2-fluoro-4-[6-isocyano-7-[[(2R)-oxiran-2-yl]methoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one (PubChem CID 58272373) has the molecular formula C28H20F2N2O4 and a molecular weight of 486.47 g/mol. Its IUPAC name is 1-[2-fluoro-4-[6-isocyano-7-[[(2R)-oxiran-2-yl]methoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one.
| Compound Name | 1-[2-fluoro-4-[6-isocyano-7-[[(2R)-oxiran-2-yl]methoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 58272373 |
| Molecular Formula | C28H20F2N2O4 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1-[2-fluoro-4-[6-isocyano-7-[[(2R)-oxiran-2-yl]methoxy]quinolin-4-yl]oxyphenyl]-3-(4-fluorophenyl)propan-2-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)Cc4ccc(F)cc4)c(F)c3)ccnc2cc1OC[C@H]1CO1 |
| InChI | InChI=1S/C28H20F2N2O4/c1-31-26-13-23-25(14-28(26)35-16-22-15-34-22)32-9-8-27(23)36-21-7-4-18(24(30)12-21)11-20(33)10-17-2-5-19(29)6-3-17/h2-9,12-14,22H,10-11,15-16H2/t22-/m1/s1 |
| InChIKey | XZTYDWOLGRCYSY-JOCHJYFZSA-N |
| XLogP | 5.99 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|