C28H22F3NO4S — CID 58249610
1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-4-sulfanylidenepentan-2-one (PubChem CID 58249610) has the molecular formula C28H22F3NO4S and a molecular weight of 525.55 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-4-sulfanylidenepentan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 58249610 |
| Molecular Formula | C28H22F3NO4S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]-4-sulfanylidenepentan-2-one |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC(=O)Cc4ccc(F)cc4F)c(F)c3)c2cc1OC |
| InChI | InChI=1S/C28H22F3NO4S/c1-34-27-14-22-25(15-28(27)35-2)32-8-7-26(22)36-20-6-4-17(24(31)13-20)10-21(37)12-19(33)9-16-3-5-18(29)11-23(16)30/h3-8,11,13-15H,9-10,12H2,1-2H3 |
| InChIKey | JRXGSZYERNFYDE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|