C29H27NO4S — CID 58249507
5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methylphenyl]-1-phenyl-4-sulfanylidenepentan-2-one (PubChem CID 58249507) has the molecular formula C29H27NO4S and a molecular weight of 485.61 g/mol. Its IUPAC name is 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methylphenyl]-1-phenyl-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methylphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 58249507 |
| Molecular Formula | C29H27NO4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-methylphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC(=O)Cc4ccccc4)c(C)c3)c2cc1OC |
| InChI | InChI=1S/C29H27NO4S/c1-19-13-23(34-27-11-12-30-26-18-29(33-3)28(32-2)17-25(26)27)10-9-21(19)15-24(35)16-22(31)14-20-7-5-4-6-8-20/h4-13,17-18H,14-16H2,1-3H3 |
| InChIKey | OPTSECTXIZYULJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|