C28H24FNO4S — CID 58249551
5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(2-fluorophenyl)-4-sulfanylidenepentan-2-one (PubChem CID 58249551) has the molecular formula C28H24FNO4S and a molecular weight of 489.57 g/mol. Its IUPAC name is 5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(2-fluorophenyl)-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(2-fluorophenyl)-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 58249551 |
| Molecular Formula | C28H24FNO4S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-(2-fluorophenyl)-4-sulfanylidenepentan-2-one |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC(=O)Cc4ccccc4F)cc3)c2cc1OC |
| InChI | InChI=1S/C28H24FNO4S/c1-32-27-16-23-25(17-28(27)33-2)30-12-11-26(23)34-21-9-7-18(8-10-21)13-22(35)15-20(31)14-19-5-3-4-6-24(19)29/h3-12,16-17H,13-15H2,1-2H3 |
| InChIKey | KABBTRFWHMPCKE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|