C30H28FNO4S — CID 58249600
6-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-methylphenyl)-5-sulfanylidenehexan-3-one (PubChem CID 58249600) has the molecular formula C30H28FNO4S and a molecular weight of 517.62 g/mol. Its IUPAC name is 6-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-methylphenyl)-5-sulfanylidenehexan-3-one.
| Compound Name | 6-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-methylphenyl)-5-sulfanylidenehexan-3-one |
|---|---|
| PubChem CID | 58249600 |
| Molecular Formula | C30H28FNO4S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 6-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-methylphenyl)-5-sulfanylidenehexan-3-one |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=S)CC(=O)CCc4ccccc4C)cc3F)c2cc1OC |
| InChI | InChI=1S/C30H28FNO4S/c1-19-6-4-5-7-21(19)9-10-22(33)16-23(37)14-20-8-11-28(25(31)15-20)36-27-12-13-32-26-18-30(35-3)29(34-2)17-24(26)27/h4-8,11-13,15,17-18H,9-10,14,16H2,1-3H3 |
| InChIKey | ZNGFTABWPNYFPX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|