C28H26N2O5 — CID 58249565
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-methyl-2-pyridinyl)pentane-2,4-dione (PubChem CID 58249565) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-methyl-2-pyridinyl)pentane-2,4-dione.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-methyl-2-pyridinyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58249565 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-methyl-2-pyridinyl)pentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)CC(=O)Cc4ncccc4C)cc3)c2cc1OC |
| InChI | InChI=1S/C28H26N2O5/c1-18-5-4-11-29-24(18)15-21(32)14-20(31)13-19-6-8-22(9-7-19)35-26-10-12-30-25-17-28(34-3)27(33-2)16-23(25)26/h4-12,16-17H,13-15H2,1-3H3 |
| InChIKey | GQKNORFGUJJHCP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|