C30H27NO7 — CID 58249424
methyl 3-[5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2,4-dioxopentyl]benzoate (PubChem CID 58249424) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is methyl 3-[5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2,4-dioxopentyl]benzoate.
| Compound Name | methyl 3-[5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2,4-dioxopentyl]benzoate |
|---|---|
| PubChem CID | 58249424 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | methyl 3-[5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2,4-dioxopentyl]benzoate |
| SMILES | COC(=O)c1cccc(CC(=O)CC(=O)Cc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cc2)c1 |
| InChI | InChI=1S/C30H27NO7/c1-35-28-17-25-26(18-29(28)36-2)31-12-11-27(25)38-24-9-7-19(8-10-24)14-22(32)16-23(33)15-20-5-4-6-21(13-20)30(34)37-3/h4-13,17-18H,14-16H2,1-3H3 |
| InChIKey | IASYWIQPOAELFT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|