C29H24F3NO5 — CID 58249411
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-[2-(trifluoromethyl)phenyl]pentane-2,4-dione (PubChem CID 58249411) has the molecular formula C29H24F3NO5 and a molecular weight of 523.51 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-[2-(trifluoromethyl)phenyl]pentane-2,4-dione.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-[2-(trifluoromethyl)phenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 58249411 |
| Molecular Formula | C29H24F3NO5 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-[2-(trifluoromethyl)phenyl]pentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)CC(=O)Cc4ccccc4C(F)(F)F)cc3)c2cc1OC |
| InChI | InChI=1S/C29H24F3NO5/c1-36-27-16-23-25(17-28(27)37-2)33-12-11-26(23)38-22-9-7-18(8-10-22)13-20(34)15-21(35)14-19-5-3-4-6-24(19)29(30,31)32/h3-12,16-17H,13-15H2,1-2H3 |
| InChIKey | MWROAVPTCWRUMY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|