C28H25NO6 — CID 58249480
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-hydroxyphenyl)pentane-2,4-dione (PubChem CID 58249480) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-hydroxyphenyl)pentane-2,4-dione.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-hydroxyphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58249480 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-5-(3-hydroxyphenyl)pentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)CC(=O)Cc4cccc(O)c4)cc3)c2cc1OC |
| InChI | InChI=1S/C28H25NO6/c1-33-27-16-24-25(17-28(27)34-2)29-11-10-26(24)35-23-8-6-18(7-9-23)12-21(31)15-22(32)14-19-4-3-5-20(30)13-19/h3-11,13,16-17,30H,12,14-15H2,1-2H3 |
| InChIKey | GQGBCLGLUURVFE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|