C27H25N3O5S — CID 59791994
N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamothioyl]-2-(3-methoxyphenyl)acetamide (PubChem CID 59791994) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamothioyl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamothioyl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 59791994 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamothioyl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)NC(=S)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cc2)c1 |
| InChI | InChI=1S/C27H25N3O5S/c1-32-20-6-4-5-17(13-20)14-26(31)30-27(36)29-18-7-9-19(10-8-18)35-23-11-12-28-22-16-25(34-3)24(33-2)15-21(22)23/h4-13,15-16H,14H2,1-3H3,(H2,29,30,31,36) |
| InChIKey | YAMMYVQCQXISGQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|