C26H25N3O6 — CID 22132728
1-(2,5-dimethoxyphenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea (PubChem CID 22132728) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 22132728 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)cc2)c1 |
| InChI | InChI=1S/C26H25N3O6/c1-31-18-9-10-23(32-2)21(13-18)29-26(30)28-16-5-7-17(8-6-16)35-22-11-12-27-20-15-25(34-4)24(33-3)14-19(20)22/h5-15H,1-4H3,(H2,28,29,30) |
| InChIKey | KPAZOQMMAGHCML-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |