C25H21BrN4O5 — CID 22935470
1-(2-bromophenyl)-3-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]urea (PubChem CID 22935470) has the molecular formula C25H21BrN4O5 and a molecular weight of 537.37 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]urea |
|---|---|
| PubChem CID | 22935470 |
| Molecular Formula | C25H21BrN4O5 |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 1-(2-bromophenyl)-3-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC(=O)Nc4ccccc4Br)cc3)c2cc1OC |
| InChI | InChI=1S/C25H21BrN4O5/c1-33-22-13-17-20(14-23(22)34-2)27-12-11-21(17)35-16-9-7-15(8-10-16)28-24(31)30-25(32)29-19-6-4-3-5-18(19)26/h3-14H,1-2H3,(H3,28,29,30,31,32) |
| InChIKey | MTHUNHMKJBZBOU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |