C27H24N4O8 — CID 91515267
methyl 2-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]carbamoylcarbamoylamino]benzoate (PubChem CID 91515267) has the molecular formula C27H24N4O8 and a molecular weight of 532.51 g/mol. Its IUPAC name is methyl 2-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]carbamoylcarbamoylamino]benzoate.
| Compound Name | methyl 2-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]carbamoylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 91515267 |
| Molecular Formula | C27H24N4O8 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | methyl 2-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-hydroxyphenyl]carbamoylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)NC(=O)Nc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cc1O |
| InChI | InChI=1S/C27H24N4O8/c1-36-23-13-17-20(14-24(23)37-2)28-11-10-22(17)39-15-8-9-19(21(32)12-15)30-27(35)31-26(34)29-18-7-5-4-6-16(18)25(33)38-3/h4-14,32H,1-3H3,(H3,29,30,31,34,35) |
| InChIKey | UKVHFFLWLSCUPK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|