C28H22FN3O4 — CID 59813803
1-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3-(2-fluorophenyl)urea (PubChem CID 59813803) has the molecular formula C28H22FN3O4 and a molecular weight of 483.50 g/mol. Its IUPAC name is 1-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 59813803 |
| Molecular Formula | C28H22FN3O4 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3-(2-fluorophenyl)urea |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=O)Nc5ccccc5F)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C28H22FN3O4/c1-34-26-15-20-24(16-27(26)35-2)30-13-12-25(20)36-18-10-11-19-17(14-18)6-5-9-22(19)31-28(33)32-23-8-4-3-7-21(23)29/h3-16H,1-2H3,(H2,31,32,33) |
| InChIKey | GNWZUUCZVKYIBQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |