C28H23N3O4 — CID 143083833
1-benzyl-3-[6-(6-hydroxy-7-methoxyquinolin-4-yl)oxynaphthalen-1-yl]urea (PubChem CID 143083833) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-benzyl-3-[6-(6-hydroxy-7-methoxyquinolin-4-yl)oxynaphthalen-1-yl]urea.
| Compound Name | 1-benzyl-3-[6-(6-hydroxy-7-methoxyquinolin-4-yl)oxynaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 143083833 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-benzyl-3-[6-(6-hydroxy-7-methoxyquinolin-4-yl)oxynaphthalen-1-yl]urea |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=O)NCc5ccccc5)cccc4c3)c2cc1O |
| InChI | InChI=1S/C28H23N3O4/c1-34-27-16-24-22(15-25(27)32)26(12-13-29-24)35-20-10-11-21-19(14-20)8-5-9-23(21)31-28(33)30-17-18-6-3-2-4-7-18/h2-16,32H,17H2,1H3,(H2,30,31,33) |
| InChIKey | OFCJAQNQPOSDPO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |