C32H31N3O3S — CID 59813737
1-(4-tert-butylphenyl)-3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]thiourea (PubChem CID 59813737) has the molecular formula C32H31N3O3S and a molecular weight of 537.69 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]thiourea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 59813737 |
| Molecular Formula | C32H31N3O3S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]thiourea |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=S)Nc5ccc(C(C)(C)C)cc5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C32H31N3O3S/c1-32(2,3)21-9-11-22(12-10-21)34-31(39)35-26-8-6-7-20-17-23(13-14-24(20)26)38-28-15-16-33-27-19-30(37-5)29(36-4)18-25(27)28/h6-19H,1-5H3,(H2,34,35,39) |
| InChIKey | VUOBQKDYQJFRKN-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|