C30H26N2O4 — CID 59813296
N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3,4-dimethylbenzamide (PubChem CID 59813296) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 59813296 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-3,4-dimethylbenzamide |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=O)c5ccc(C)c(C)c5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C30H26N2O4/c1-18-8-9-21(14-19(18)2)30(33)32-25-7-5-6-20-15-22(10-11-23(20)25)36-27-12-13-31-26-17-29(35-4)28(34-3)16-24(26)27/h5-17H,1-4H3,(H,32,33) |
| InChIKey | DXTWXBDAAYSUDY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |