C29H24N2O4 — CID 59813522
N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-2-phenylacetamide (PubChem CID 59813522) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-2-phenylacetamide.
| Compound Name | N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 59813522 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-1-yl]-2-phenylacetamide |
| SMILES | COc1cc2nccc(Oc3ccc4c(NC(=O)Cc5ccccc5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C29H24N2O4/c1-33-27-17-23-25(18-28(27)34-2)30-14-13-26(23)35-21-11-12-22-20(16-21)9-6-10-24(22)31-29(32)15-19-7-4-3-5-8-19/h3-14,16-18H,15H2,1-2H3,(H,31,32) |
| InChIKey | LICMNRYWGWZIRR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |