C29H24N2O4 — CID 67520391
N-benzyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalene-2-carboxamide (PubChem CID 67520391) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-benzyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalene-2-carboxamide.
| Compound Name | N-benzyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67520391 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-benzyl-6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalene-2-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc4cc(C(=O)NCc5ccccc5)ccc4c3)c2cc1OC |
| InChI | InChI=1S/C29H24N2O4/c1-33-27-16-24-25(17-28(27)34-2)30-13-12-26(24)35-23-11-10-20-14-22(9-8-21(20)15-23)29(32)31-18-19-6-4-3-5-7-19/h3-17H,18H2,1-2H3,(H,31,32) |
| InChIKey | YDBWZPPEJZLDAI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |