C25H24N4O4 — CID 11626442
1-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-3-(2-phenylethyl)urea (PubChem CID 11626442) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 1-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 11626442 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-3-(2-phenylethyl)urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NCCc4ccccc4)nc3)c2cc1OC |
| InChI | InChI=1S/C25H24N4O4/c1-31-22-14-19-20(15-23(22)32-2)26-13-11-21(19)33-18-8-9-24(28-16-18)29-25(30)27-12-10-17-6-4-3-5-7-17/h3-9,11,13-16H,10,12H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | PZWAFATUEHSEFY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |