C27H23ClN4O5 — CID 143321266
(2Z)-N-(2-chlorophenyl)-N'-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2-ethylidenepropanediamide (PubChem CID 143321266) has the molecular formula C27H23ClN4O5 and a molecular weight of 518.96 g/mol. Its IUPAC name is (2Z)-N-(2-chlorophenyl)-N'-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2-ethylidenepropanediamide.
| Compound Name | (2Z)-N-(2-chlorophenyl)-N'-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2-ethylidenepropanediamide |
|---|---|
| PubChem CID | 143321266 |
| Molecular Formula | C27H23ClN4O5 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (2Z)-N-(2-chlorophenyl)-N'-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2-ethylidenepropanediamide |
| SMILES | C/C=C(\C(=O)Nc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cn1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H23ClN4O5/c1-4-17(26(33)31-20-8-6-5-7-19(20)28)27(34)32-25-10-9-16(15-30-25)37-22-11-12-29-21-14-24(36-3)23(35-2)13-18(21)22/h4-15H,1-3H3,(H,31,33)(H,30,32,34)/b17-4- |
| InChIKey | KPIZXDIRVWBYDO-INGKJJEOSA-N |
| XLogP | 5.62 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|