C19H15ClN4O5S — CID 143152221
4-[[6-[(2-chloroacetyl)carbamoylamino]-3-pyridinyl]oxy]-6-methoxyquinoline-7-carbothioic S-acid (PubChem CID 143152221) has the molecular formula C19H15ClN4O5S and a molecular weight of 446.87 g/mol. Its IUPAC name is 4-[[6-[(2-chloroacetyl)carbamoylamino]-3-pyridinyl]oxy]-6-methoxyquinoline-7-carbothioic S-acid.
| Compound Name | 4-[[6-[(2-chloroacetyl)carbamoylamino]-3-pyridinyl]oxy]-6-methoxyquinoline-7-carbothioic S-acid |
|---|---|
| PubChem CID | 143152221 |
| Molecular Formula | C19H15ClN4O5S |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-[[6-[(2-chloroacetyl)carbamoylamino]-3-pyridinyl]oxy]-6-methoxyquinoline-7-carbothioic S-acid |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NC(=O)CCl)nc3)ccnc2cc1C(=O)S |
| InChI | InChI=1S/C19H15ClN4O5S/c1-28-15-7-11-13(6-12(15)18(26)30)21-5-4-14(11)29-10-2-3-16(22-9-10)23-19(27)24-17(25)8-20/h2-7,9H,8H2,1H3,(H,26,30)(H2,22,23,24,25,27) |
| InChIKey | BLTMIZXYUIXRDV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|