C31H26FNO6 — CID 159464647
methyl 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinoline-7-carboxylate (PubChem CID 159464647) has the molecular formula C31H26FNO6 and a molecular weight of 527.55 g/mol. Its IUPAC name is methyl 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinoline-7-carboxylate.
| Compound Name | methyl 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinoline-7-carboxylate |
|---|---|
| PubChem CID | 159464647 |
| Molecular Formula | C31H26FNO6 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | methyl 4-[4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinoline-7-carboxylate |
| SMILES | COC(=O)c1cc2nccc(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3)c2cc1OC |
| InChI | InChI=1S/C31H26FNO6/c1-37-27-18-23-25(17-24(27)30(36)38-2)33-14-11-26(23)39-22-9-5-20(6-10-22)16-29(35)31(12-13-31)28(34)15-19-3-7-21(32)8-4-19/h3-11,14,17-18H,12-13,15-16H2,1-2H3 |
| InChIKey | LVAIFHISVAYADX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|