C32H27F2NO6 — CID 165009767
3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropanal (PubChem CID 165009767) has the molecular formula C32H27F2NO6 and a molecular weight of 559.57 g/mol. Its IUPAC name is 3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropanal.
| Compound Name | 3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropanal |
|---|---|
| PubChem CID | 165009767 |
| Molecular Formula | C32H27F2NO6 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropanal |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCC=O |
| InChI | InChI=1S/C32H27F2NO6/c1-39-28-18-23-25(19-29(28)40-14-2-13-36)35-12-9-26(23)41-27-8-5-21(15-24(27)34)17-31(38)32(10-11-32)30(37)16-20-3-6-22(33)7-4-20/h3-9,12-13,15,18-19H,2,10-11,14,16-17H2,1H3 |
| InChIKey | JNEVPGWPSGVJOF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|