C35H33F2NO5S — CID 164989958
1-[1-[2-[3-fluoro-4-[6-methoxy-7-[(E)-6-sulfanylhex-3-enoxy]quinolin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 164989958) has the molecular formula C35H33F2NO5S and a molecular weight of 617.71 g/mol. Its IUPAC name is 1-[1-[2-[3-fluoro-4-[6-methoxy-7-[(E)-6-sulfanylhex-3-enoxy]quinolin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[3-fluoro-4-[6-methoxy-7-[(E)-6-sulfanylhex-3-enoxy]quinolin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 164989958 |
| Molecular Formula | C35H33F2NO5S |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 1-[1-[2-[3-fluoro-4-[6-methoxy-7-[(E)-6-sulfanylhex-3-enoxy]quinolin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCC/C=C/CCS |
| InChI | InChI=1S/C35H33F2NO5S/c1-41-31-21-26-28(22-32(31)42-16-4-2-3-5-17-44)38-15-12-29(26)43-30-11-8-24(18-27(30)37)20-34(40)35(13-14-35)33(39)19-23-6-9-25(36)10-7-23/h2-3,6-12,15,18,21-22,44H,4-5,13-14,16-17,19-20H2,1H3/b3-2+ |
| InChIKey | GSCWHUQDUOZJHT-NSCUHMNNSA-N |
| XLogP | 7.66 |
| TPSA | 74.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|