C30H26FNO6 — CID 165058470
2-(4-fluorophenyl)-1-[1-[2-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxy-3-methoxyphenyl]acetyl]cyclopropyl]ethanone (PubChem CID 165058470) has the molecular formula C30H26FNO6 and a molecular weight of 515.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[1-[2-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxy-3-methoxyphenyl]acetyl]cyclopropyl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[1-[2-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxy-3-methoxyphenyl]acetyl]cyclopropyl]ethanone |
|---|---|
| PubChem CID | 165058470 |
| Molecular Formula | C30H26FNO6 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[1-[2-[4-(7-hydroxy-6-methoxyquinolin-4-yl)oxy-3-methoxyphenyl]acetyl]cyclopropyl]ethanone |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3OC)ccnc2cc1O |
| InChI | InChI=1S/C30H26FNO6/c1-36-26-16-21-22(17-23(26)33)32-12-9-24(21)38-25-8-5-19(13-27(25)37-2)15-29(35)30(10-11-30)28(34)14-18-3-6-20(31)7-4-18/h3-9,12-13,16-17,33H,10-11,14-15H2,1-2H3 |
| InChIKey | QUVBTBZXJRWICM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|