C34H27FN2O4 — CID 159526635
1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-(7-methoxy-6-pyridin-2-ylquinolin-4-yl)oxyphenyl]ethanone (PubChem CID 159526635) has the molecular formula C34H27FN2O4 and a molecular weight of 546.60 g/mol. Its IUPAC name is 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-(7-methoxy-6-pyridin-2-ylquinolin-4-yl)oxyphenyl]ethanone.
| Compound Name | 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-(7-methoxy-6-pyridin-2-ylquinolin-4-yl)oxyphenyl]ethanone |
|---|---|
| PubChem CID | 159526635 |
| Molecular Formula | C34H27FN2O4 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 1-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-[4-(7-methoxy-6-pyridin-2-ylquinolin-4-yl)oxyphenyl]ethanone |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3)c2cc1-c1ccccn1 |
| InChI | InChI=1S/C34H27FN2O4/c1-40-31-21-29-27(20-26(31)28-4-2-3-16-36-28)30(13-17-37-29)41-25-11-7-23(8-12-25)19-33(39)34(14-15-34)32(38)18-22-5-9-24(35)10-6-22/h2-13,16-17,20-21H,14-15,18-19H2,1H3 |
| InChIKey | MCLTZUZVMZJARS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|