C36H36F2N2O7 — CID 157288765
methyl 3-[3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropylamino]propanoate (PubChem CID 157288765) has the molecular formula C36H36F2N2O7 and a molecular weight of 646.69 g/mol. Its IUPAC name is methyl 3-[3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropylamino]propanoate.
| Compound Name | methyl 3-[3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropylamino]propanoate |
|---|---|
| PubChem CID | 157288765 |
| Molecular Formula | C36H36F2N2O7 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | methyl 3-[3-[4-[2-fluoro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-6-methoxyquinolin-7-yl]oxypropylamino]propanoate |
| SMILES | COC(=O)CCNCCCOc1cc2nccc(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C36H36F2N2O7/c1-44-31-21-26-28(22-32(31)46-17-3-14-39-15-11-35(43)45-2)40-16-10-29(26)47-30-9-6-24(18-27(30)38)20-34(42)36(12-13-36)33(41)19-23-4-7-25(37)8-5-23/h4-10,16,18,21-22,39H,3,11-15,17,19-20H2,1-2H3 |
| InChIKey | RVMQGXHNDKJWCN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|